CAS 2368911-32-2 appears in our catalog under these names: Rel-tert-butyl (3R,4S)-3-hydroxy-4-methoxypyrrolidine-1-carboxylate, 95%, 1-Pyrrolidinecarboxylic acid, 3-hydroxy-4-methoxy-, 1,1-dimethylethyl ester, (3R,4S)-rel-, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g.
Tert-butyl (3R,4S)-3-hydroxy-4-methoxypyrrolidine-1-carboxylate (CAS 2368911-32-2) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl (3R,4S)-3-hydroxy-4-methoxypyrrolidine-1-carboxylate. InChIKey: XAJCELXHUNUFBB-SFYZADRCSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-hydroxy-4-methoxypyrrolidine-1-carboxylate |
| InChIKey | XAJCELXHUNUFBB-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](C1)OC)O |
Computed by PubChem (NCBI)