CAS 2369017-79-6 is the registry number for 2-(3-Cyano-4,5-dimethyl-5-phenylfuran-2(5H)-ylidene)malononitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-cyano-4,5-dimethyl-5-phenylfuran-2-ylidene)propanedinitrile (CAS 2369017-79-6) is a chemical compound with the molecular formula C16H11N3O and a molecular weight of 261.28 g/mol. IUPAC name: 2-(3-cyano-4,5-dimethyl-5-phenylfuran-2-ylidene)propanedinitrile. InChIKey: OMTDNHGSUNEUOK-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O |
|---|---|
| Molecular weight | 261.28 g/mol |
| IUPAC name | 2-(3-cyano-4,5-dimethyl-5-phenylfuran-2-ylidene)propanedinitrile |
| InChIKey | OMTDNHGSUNEUOK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C#N)C#N)OC1(C)C2=CC=CC=C2)C#N |
Computed by PubChem (NCBI)