CAS 2369750-66-1 is the registry number for G108/ 99.94% (existing batch purity). Offered by: TargetMol. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
1-[6,7-dichloro-9-(1H-pyrazol-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone (CAS 2369750-66-1) is a chemical compound with the molecular formula C16H14Cl2N4O2 and a molecular weight of 365.2 g/mol. IUPAC name: 1-[6,7-dichloro-9-(1H-pyrazol-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone. InChIKey: UUDFSTGSYHGEEV-UHFFFAOYSA-N.
| Molecular formula | C16H14Cl2N4O2 |
|---|---|
| Molecular weight | 365.2 g/mol |
| IUPAC name | 1-[6,7-dichloro-9-(1H-pyrazol-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl]-2-hydroxyethanone |
| InChIKey | UUDFSTGSYHGEEV-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1NC3=C2C(=CC(=C3Cl)Cl)C4=CNN=C4)C(=O)CO |
Computed by PubChem (NCBI)