CAS 2370-44-7 is the registry number for 2-(3-Chloro-4-fluoroanilino)acetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2-(3-chloro-4-fluoroanilino)acetohydrazide (CAS 2370-44-7) is a chemical compound with the molecular formula C8H9ClFN3O and a molecular weight of 217.63 g/mol. IUPAC name: 2-(3-chloro-4-fluoroanilino)acetohydrazide. InChIKey: KVTCQXCNZAAMDB-UHFFFAOYSA-N.
| Molecular formula | C8H9ClFN3O |
|---|---|
| Molecular weight | 217.63 g/mol |
| IUPAC name | 2-(3-chloro-4-fluoroanilino)acetohydrazide |
| InChIKey | KVTCQXCNZAAMDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NCC(=O)NN)Cl)F |
Computed by PubChem (NCBI)