CAS 23709-47-9 appears in our catalog under these names: 3–Nitro–7–azaindole, 3-Nitro-1H-pyrrolo[2,3-b]pyridine, 96%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g.
3-nitro-1H-pyrrolo[2,3-b]pyridine (CAS 23709-47-9) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 3-nitro-1H-pyrrolo[2,3-b]pyridine. InChIKey: DTLVPICXPRRMOQ-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 3-nitro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | DTLVPICXPRRMOQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC=C2[N+](=O)[O-])N=C1 |
Computed by PubChem (NCBI)