CAS 23732-40-3 appears in our catalog under these names: L-Erythrono-1,4-lactone, 95%, L-Erythrono-1,4-lactone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 2000mg, 1000mg.
(3S,4S)-3,4-dihydroxyoxolan-2-one (CAS 23732-40-3) is a chemical compound with the molecular formula C4H6O4 and a molecular weight of 118.09 g/mol. IUPAC name: (3S,4S)-3,4-dihydroxyoxolan-2-one. InChIKey: SGMJBNSHAZVGMC-HRFVKAFMSA-N.
| Molecular formula | C4H6O4 |
|---|---|
| Molecular weight | 118.09 g/mol |
| IUPAC name | (3S,4S)-3,4-dihydroxyoxolan-2-one |
| InChIKey | SGMJBNSHAZVGMC-HRFVKAFMSA-N |
| SMILES | C1[C@@H]([C@@H](C(=O)O1)O)O |
Computed by PubChem (NCBI)