CAS 2373379-54-3 is the registry number for Diphenyl(2'-(triethylsilyl)-[1,1'-binaphthalen]-2-yl)phosphane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Diphenyl-[1-(2-triethylsilylnaphthalen-1-yl)naphthalen-2-yl]phosphane (CAS 2373379-54-3) is a chemical compound with the molecular formula C38H37PSi and a molecular weight of 552.8 g/mol. IUPAC name: diphenyl-[1-(2-triethylsilylnaphthalen-1-yl)naphthalen-2-yl]phosphane. InChIKey: DXIFASCYMASVKF-UHFFFAOYSA-N.
| Molecular formula | C38H37PSi |
|---|---|
| Molecular weight | 552.8 g/mol |
| IUPAC name | diphenyl-[1-(2-triethylsilylnaphthalen-1-yl)naphthalen-2-yl]phosphane |
| InChIKey | DXIFASCYMASVKF-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)C1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)P(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)