Products 237399-27-8
CAS 237399-27-8 is the registry number for Guanosine Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-7-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 237399-27-8) is a chemical compound with the molecular formula C10H12FN5O4 and a molecular weight of 285.23 g/mol. IUPAC name: 2-amino-7-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: FHZUZEMURQZKIO-DXTOWSMRSA-N.
| Molecular formula | C10H12FN5O4 |
|---|---|
| Molecular weight | 285.23 g/mol |
| IUPAC name | 2-amino-7-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | FHZUZEMURQZKIO-DXTOWSMRSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)F)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)