CAS 20535-16-4 appears in our catalog under these names: 3’-Deoxy-3’-fluoro-xyloadenosine 97%, 3’-Deoxy-3’-fluoro-xyloadenosine, 97%, 97%, 3’-Deoxy-3’-fluoro-xyloadenosine. Offered by: Ambeed, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 5mg, 10mg, 10 mg, 50 mg, 1 mg.
(2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-3-fluoro-2-(hydroxymethyl)oxolane-3,4-diol (CAS 20535-16-4) is a chemical compound with the molecular formula C10H12FN5O4 and a molecular weight of 285.23 g/mol. IUPAC name: (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-3-fluoro-2-(hydroxymethyl)oxolane-3,4-diol. InChIKey: HJQMFSDWWCLFTC-TWJUVVLDSA-N.
| Molecular formula | C10H12FN5O4 |
|---|---|
| Molecular weight | 285.23 g/mol |
| IUPAC name | (2R,3S,4S,5R)-5-(6-aminopurin-9-yl)-3-fluoro-2-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | HJQMFSDWWCLFTC-TWJUVVLDSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@]([C@H](O3)CO)(O)F)O)N |
Computed by PubChem (NCBI)