Products 237413-05-7
CAS 237413-05-7 is the registry number for (3-(Diethylcarbamoyl)phenyl)boronic acid, 97%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
[3-(diethylcarbamoyl)phenyl]boronic acid (CAS 237413-05-7) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [3-(diethylcarbamoyl)phenyl]boronic acid. InChIKey: DDHUSSNOKNYLAI-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | [3-(diethylcarbamoyl)phenyl]boronic acid |
| InChIKey | DDHUSSNOKNYLAI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N(CC)CC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(N,N-Diethylaminocarbonyl)phenylboronic acid, (3-(Diethylcarbamoyl)phenyl)boronic acid, [3-(diethylcarbamoyl)phenyl]boronic Acid, 3-(diethylcarbamoyl)phenylboronic acid, 3-(Diethylcarbamoyl)benzeneboronic acid, DDHUSSNOKNYLAI-UHFFFAOYSA-N, 3-(N,N-diethylaminocarbonyl)phenylboronic acid, AldrichCPR