Products 2374139-68-9
CAS 2374139-68-9 is the registry number for P-CAB agent 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[3-[[3-(2-fluorophenyl)-5-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]methyl]phenyl]benzamide (CAS 2374139-68-9) is a chemical compound with the molecular formula C26H23FN4O and a molecular weight of 426.5 g/mol. IUPAC name: 3-[3-[[3-(2-fluorophenyl)-5-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]methyl]phenyl]benzamide. InChIKey: LGPYOKZMSVIUGM-UHFFFAOYSA-N.
| Molecular formula | C26H23FN4O |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | 3-[3-[[3-(2-fluorophenyl)-5-methyl-4,6-dihydropyrrolo[3,4-c]pyrazol-2-yl]methyl]phenyl]benzamide |
| InChIKey | LGPYOKZMSVIUGM-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(N(N=C2C1)CC3=CC(=CC=C3)C4=CC(=CC=C4)C(=O)N)C5=CC=CC=C5F |
Computed by PubChem (NCBI)
Synonyms:
P-CAB agent 1, orb1687726