Products 2374723-26-7
CAS 2374723-26-7 is the registry number for As-358 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-piperidin-1-ylpropanoate;hydrochloride (CAS 2374723-26-7) is a chemical compound with the molecular formula C18H32ClNO2 and a molecular weight of 329.9 g/mol. IUPAC name: [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-piperidin-1-ylpropanoate;hydrochloride. InChIKey: XPTSIMRWHCGMRT-POFIYQJBSA-N.
| Molecular formula | C18H32ClNO2 |
|---|---|
| Molecular weight | 329.9 g/mol |
| IUPAC name | [(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 3-piperidin-1-ylpropanoate;hydrochloride |
| InChIKey | XPTSIMRWHCGMRT-POFIYQJBSA-N |
| SMILES | C[C@]12CC[C@H](C1(C)C)C[C@H]2OC(=O)CCN3CCCCC3.Cl |
Computed by PubChem (NCBI)
Synonyms:
As-358 hydrochloride, orb1689076