CAS 2374758-30-0 is the registry number for 4-Bromo-1-(2,2-difluoropropyl)-3-iodo-1h-pyrrolo[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
4-bromo-1-(2,2-difluoropropyl)-3-iodopyrrolo[2,3-b]pyridine (CAS 2374758-30-0) is a chemical compound with the molecular formula C10H8BrF2IN2 and a molecular weight of 400.99 g/mol. IUPAC name: 4-bromo-1-(2,2-difluoropropyl)-3-iodopyrrolo[2,3-b]pyridine. InChIKey: MFIODXWWOHFULD-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF2IN2 |
|---|---|
| Molecular weight | 400.99 g/mol |
| IUPAC name | 4-bromo-1-(2,2-difluoropropyl)-3-iodopyrrolo[2,3-b]pyridine |
| InChIKey | MFIODXWWOHFULD-UHFFFAOYSA-N |
| SMILES | CC(CN1C=C(C2=C(C=CN=C21)Br)I)(F)F |
Computed by PubChem (NCBI)