Products 2374804-69-8
CAS 2374804-69-8 is the registry number for N-[4-(DIMETHYLAMINO)PHENYL]-4-(DIMETHYLAMINO)PYRIDINE-2-CARBOXAMIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(dimethylamino)-N-[4-(dimethylamino)phenyl]pyridine-2-carboxamide (CAS 2374804-69-8) is a chemical compound with the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. IUPAC name: 4-(dimethylamino)-N-[4-(dimethylamino)phenyl]pyridine-2-carboxamide. InChIKey: KVMQQRRSEHEEQA-UHFFFAOYSA-N.
| Molecular formula | C16H20N4O |
|---|---|
| Molecular weight | 284.36 g/mol |
| IUPAC name | 4-(dimethylamino)-N-[4-(dimethylamino)phenyl]pyridine-2-carboxamide |
| InChIKey | KVMQQRRSEHEEQA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)NC(=O)C2=NC=CC(=C2)N(C)C |
Computed by PubChem (NCBI)