Products 2374971-82-9
CAS 2374971-82-9 appears in our catalog under these names: (S,S)–CPI–1612, (S,S)-CPI-1612, 99.88%, (S,S)-CPI-1612. Offered by: GLPBio, MedChemExpress, Fluorochem, Chemat. Available pack sizes: 1mg, 50 mg, 25 mg, 5 mg, 10 mg, 5mg.
(2S)-2-[[(2S)-2-(4-cyanophenyl)propyl]amino]-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]-2-phenylacetamide (CAS 2374971-82-9) is a chemical compound with the molecular formula C27H26N6O and a molecular weight of 450.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(4-cyanophenyl)propyl]amino]-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]-2-phenylacetamide. InChIKey: SEDFZSHSBUXKAC-BCHFMIIMSA-N.
| Molecular formula | C27H26N6O |
|---|---|
| Molecular weight | 450.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(4-cyanophenyl)propyl]amino]-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]-2-phenylacetamide |
| InChIKey | SEDFZSHSBUXKAC-BCHFMIIMSA-N |
| SMILES | C[C@H](CN[C@@H](C1=CC=CC=C1)C(=O)NC2=NC=C(C=C2)C3=CN(N=C3)C)C4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)