Products 2374972-35-5
CAS 2374972-35-5 appears in our catalog under these names: (R,R)–CPI–1612, (R,R)-CPI-1612, 99%, 99%, (R,R)-CPI-1612, 99.49%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10 mg, 25 mg, 10mM/1mL, 5 mg, 1 mg.
(2R)-2-[[(2R)-2-(4-cyanophenyl)propyl]amino]-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]-2-phenylacetamide (CAS 2374972-35-5) is a chemical compound with the molecular formula C27H26N6O and a molecular weight of 450.5 g/mol. IUPAC name: (2R)-2-[[(2R)-2-(4-cyanophenyl)propyl]amino]-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]-2-phenylacetamide. InChIKey: SEDFZSHSBUXKAC-AFMDSPMNSA-N.
| Molecular formula | C27H26N6O |
|---|---|
| Molecular weight | 450.5 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-(4-cyanophenyl)propyl]amino]-N-[5-(1-methylpyrazol-4-yl)-2-pyridinyl]-2-phenylacetamide |
| InChIKey | SEDFZSHSBUXKAC-AFMDSPMNSA-N |
| SMILES | C[C@@H](CN[C@H](C1=CC=CC=C1)C(=O)NC2=NC=C(C=C2)C3=CN(N=C3)C)C4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)