CAS 2375043-73-3 is the registry number for TCR-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[[3-(pyrrolidin-1-ylmethyl)-4-[4-(trifluoromethyl)phenyl]-2H-chromen-6-yl]oxy]propanoic acid (CAS 2375043-73-3) is a chemical compound with the molecular formula C24H24F3NO4 and a molecular weight of 447.4 g/mol. IUPAC name: 3-[[3-(pyrrolidin-1-ylmethyl)-4-[4-(trifluoromethyl)phenyl]-2H-chromen-6-yl]oxy]propanoic acid. InChIKey: DQLIXGDDVSFKEB-UHFFFAOYSA-N.
| Molecular formula | C24H24F3NO4 |
|---|---|
| Molecular weight | 447.4 g/mol |
| IUPAC name | 3-[[3-(pyrrolidin-1-ylmethyl)-4-[4-(trifluoromethyl)phenyl]-2H-chromen-6-yl]oxy]propanoic acid |
| InChIKey | DQLIXGDDVSFKEB-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=C(C3=C(C=CC(=C3)OCCC(=O)O)OC2)C4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)