Products 2375069-08-0
CAS 2375069-08-0 is the registry number for 3-(4-Methylphenyl)-4-(3,4,5-trimethoxyphenyl)-1H-pyrazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)-1H-pyrazole (CAS 2375069-08-0) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 324.4 g/mol. IUPAC name: 5-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)-1H-pyrazole. InChIKey: IBVZRZBBOWOKKX-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O3 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 5-(4-methylphenyl)-4-(3,4,5-trimethoxyphenyl)-1H-pyrazole |
| InChIKey | IBVZRZBBOWOKKX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(C=NN2)C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)