Products 2375165-28-7
CAS 2375165-28-7 is the registry number for Tert-butyl (3R,4S)-3-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (3R,4S)-3-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate (CAS 2375165-28-7) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (3R,4S)-3-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate. InChIKey: QNVPXIMDUBAIPY-RKDXNWHRSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-(hydroxymethyl)-4-methylpyrrolidine-1-carboxylate |
| InChIKey | QNVPXIMDUBAIPY-RKDXNWHRSA-N |
| SMILES | C[C@@H]1CN(C[C@@H]1CO)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)