CAS 2375165-38-9 is the registry number for (3R,5R)-5-(tert-butoxycarbonylamino)tetrahydropyran-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(3R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-3-carboxylic acid (CAS 2375165-38-9) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (3R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-3-carboxylic acid. InChIKey: ZUXNWTSXNXSGIT-HTQZYQBOSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (3R,5R)-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-3-carboxylic acid |
| InChIKey | ZUXNWTSXNXSGIT-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](COC1)C(=O)O |
Computed by PubChem (NCBI)