Products 2375195-87-0
CAS 2375195-87-0 is the registry number for 2-[4-amino-5-(trifluoromethyl)-2-pyridyl]acetic acid,hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-[4-amino-5-(trifluoromethyl)-2-pyridinyl]acetic acid;hydrochloride (CAS 2375195-87-0) is a chemical compound with the molecular formula C8H8ClF3N2O2 and a molecular weight of 256.61 g/mol. IUPAC name: 2-[4-amino-5-(trifluoromethyl)-2-pyridinyl]acetic acid;hydrochloride. InChIKey: VZWIWMHNSSNZBF-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF3N2O2 |
|---|---|
| Molecular weight | 256.61 g/mol |
| IUPAC name | 2-[4-amino-5-(trifluoromethyl)-2-pyridinyl]acetic acid;hydrochloride |
| InChIKey | VZWIWMHNSSNZBF-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=C1N)C(F)(F)F)CC(=O)O.Cl |
Computed by PubChem (NCBI)