CAS 2375196-40-8 appears in our catalog under these names: TNIK–IN–6, TNIK-IN-6, 96.92%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 10 mg, 5 mg, 1 mg, 25 mg.
5-bromo-2-(2-fluoro-4-pyridinyl)-1,7-naphthyridin-8-amine (CAS 2375196-40-8) is a chemical compound with the molecular formula C13H8BrFN4 and a molecular weight of 319.13 g/mol. IUPAC name: 5-bromo-2-(2-fluoro-4-pyridinyl)-1,7-naphthyridin-8-amine. InChIKey: KARJFNUGCLEZKM-UHFFFAOYSA-N.
| Molecular formula | C13H8BrFN4 |
|---|---|
| Molecular weight | 319.13 g/mol |
| IUPAC name | 5-bromo-2-(2-fluoro-4-pyridinyl)-1,7-naphthyridin-8-amine |
| InChIKey | KARJFNUGCLEZKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=CN=C2N)Br)C3=CC(=NC=C3)F |
Computed by PubChem (NCBI)