Products 2375196-54-4
CAS 2375196-54-4 is the registry number for SL agonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-fluoro-4-nitrophenoxy)-4-methyl-2H-furan-5-one (CAS 2375196-54-4) is a chemical compound with the molecular formula C11H8FNO5 and a molecular weight of 253.18 g/mol. IUPAC name: 2-(2-fluoro-4-nitrophenoxy)-4-methyl-2H-furan-5-one. InChIKey: WIIYUGBOBAZDTQ-UHFFFAOYSA-N.
| Molecular formula | C11H8FNO5 |
|---|---|
| Molecular weight | 253.18 g/mol |
| IUPAC name | 2-(2-fluoro-4-nitrophenoxy)-4-methyl-2H-furan-5-one |
| InChIKey | WIIYUGBOBAZDTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(OC1=O)OC2=C(C=C(C=C2)[N+](=O)[O-])F |
Computed by PubChem (NCBI)
Synonyms:
SL agonist 1, orb2665351