Products 2375196-68-0
CAS 2375196-68-0 is the registry number for E3 ligase Ligand 41. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[[3-[(2-chloroacetyl)amino]-5-(trifluoromethyl)benzoyl]amino]propanoic acid (CAS 2375196-68-0) is a chemical compound with the molecular formula C13H12ClF3N2O4 and a molecular weight of 352.69 g/mol. IUPAC name: 3-[[3-[(2-chloroacetyl)amino]-5-(trifluoromethyl)benzoyl]amino]propanoic acid. InChIKey: GDJKFDRRSBFLCR-UHFFFAOYSA-N.
| Molecular formula | C13H12ClF3N2O4 |
|---|---|
| Molecular weight | 352.69 g/mol |
| IUPAC name | 3-[[3-[(2-chloroacetyl)amino]-5-(trifluoromethyl)benzoyl]amino]propanoic acid |
| InChIKey | GDJKFDRRSBFLCR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)NC(=O)CCl)C(=O)NCCC(=O)O |
Computed by PubChem (NCBI)