CAS 2375254-73-0 is the registry number for (3S,4S)-3-Amino-4-hydroxy-1-methyl-1λâµ-phospholan-1-one. Offered by: Biosynth. Available pack sizes: 10mg, 0,1g.
(3S,4S)-4-amino-1-methyl-1-oxo-1lambda5-phospholan-3-ol (CAS 2375254-73-0) is a chemical compound with the molecular formula C5H12NO2P and a molecular weight of 149.13 g/mol. IUPAC name: (3S,4S)-4-amino-1-methyl-1-oxo-1lambda5-phospholan-3-ol. InChIKey: WUAQQCNHQRQXRQ-DALOQNNESA-N.
| Molecular formula | C5H12NO2P |
|---|---|
| Molecular weight | 149.13 g/mol |
| IUPAC name | (3S,4S)-4-amino-1-methyl-1-oxo-1lambda5-phospholan-3-ol |
| InChIKey | WUAQQCNHQRQXRQ-DALOQNNESA-N |
| SMILES | CP1(=O)C[C@H]([C@@H](C1)O)N |
Computed by PubChem (NCBI)