CAS 2375260-05-0 appears in our catalog under these names: Lithium 2-oxaspiro(3.3)heptane-6-carboxylate, 95%, Lithium 2-oxaspiro(3.3)heptane-6-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Lithium 2-oxaspiro[3.3]heptane-6-carboxylate (CAS 2375260-05-0) is a chemical compound with the molecular formula C7H9LiO3 and a molecular weight of 148.1 g/mol. IUPAC name: lithium 2-oxaspiro[3.3]heptane-6-carboxylate. InChIKey: ALEITJVDWOKFQW-UHFFFAOYSA-M.
| Molecular formula | C7H9LiO3 |
|---|---|
| Molecular weight | 148.1 g/mol |
| IUPAC name | lithium 2-oxaspiro[3.3]heptane-6-carboxylate |
| InChIKey | ALEITJVDWOKFQW-UHFFFAOYSA-M |
| SMILES | [Li+].C1C(CC12COC2)C(=O)[O-] |
Computed by PubChem (NCBI)