CAS 2375267-61-9 is the registry number for Methyl 2-amino-3-(2,5-dichlorothiophen-3-yl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-amino-3-(2,5-dichlorothiophen-3-yl)propanoate;hydrochloride (CAS 2375267-61-9) is a chemical compound with the molecular formula C8H10Cl3NO2S and a molecular weight of 290.6 g/mol. IUPAC name: methyl 2-amino-3-(2,5-dichlorothiophen-3-yl)propanoate;hydrochloride. InChIKey: JOCRQCSBGWXYMK-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO2S |
|---|---|
| Molecular weight | 290.6 g/mol |
| IUPAC name | methyl 2-amino-3-(2,5-dichlorothiophen-3-yl)propanoate;hydrochloride |
| InChIKey | JOCRQCSBGWXYMK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=C(SC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)