Products 2375268-07-6
CAS 2375268-07-6 is the registry number for tert-Butyl 6-amino-7,7-dimethyl-2-azabicyclo(3.2.0)heptane-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 6-amino-7,7-dimethyl-2-azabicyclo[3.2.0]heptane-2-carboxylate (CAS 2375268-07-6) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl 6-amino-7,7-dimethyl-2-azabicyclo[3.2.0]heptane-2-carboxylate. InChIKey: CTAUKBQIMWCOPA-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl 6-amino-7,7-dimethyl-2-azabicyclo[3.2.0]heptane-2-carboxylate |
| InChIKey | CTAUKBQIMWCOPA-UHFFFAOYSA-N |
| SMILES | CC1(C(C2C1N(CC2)C(=O)OC(C)(C)C)N)C |
Computed by PubChem (NCBI)