CAS 2375269-74-0 is the registry number for 5-(Aminomethyl)thieno(3,2-b)thiophene-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylic acid;hydrochloride (CAS 2375269-74-0) is a chemical compound with the molecular formula C8H8ClNO2S2 and a molecular weight of 249.7 g/mol. IUPAC name: 2-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylic acid;hydrochloride. InChIKey: QOFVXSCBKOJTRT-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2S2 |
|---|---|
| Molecular weight | 249.7 g/mol |
| IUPAC name | 2-(aminomethyl)thieno[3,2-b]thiophene-5-carboxylic acid;hydrochloride |
| InChIKey | QOFVXSCBKOJTRT-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1SC(=C2)C(=O)O)CN.Cl |
Computed by PubChem (NCBI)