CAS 2375270-10-1 is the registry number for 2,3,4-Trimethyl-1H-indol-5-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,3,4-trimethyl-1H-indol-5-amine;hydrochloride (CAS 2375270-10-1) is a chemical compound with the molecular formula C11H15ClN2 and a molecular weight of 210.70 g/mol. IUPAC name: 2,3,4-trimethyl-1H-indol-5-amine;hydrochloride. InChIKey: UHUIPYAIRGIGON-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2 |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 2,3,4-trimethyl-1H-indol-5-amine;hydrochloride |
| InChIKey | UHUIPYAIRGIGON-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C(=C(C=C2)N)C)C.Cl |
Computed by PubChem (NCBI)