CAS 2375270-96-3 is the registry number for 3-Amino-2-(4,4-difluorocyclohexyl)-1,1,1-trifluoropropan-2-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-amino-2-(4,4-difluorocyclohexyl)-1,1,1-trifluoropropan-2-ol;hydrochloride (CAS 2375270-96-3) is a chemical compound with the molecular formula C9H15ClF5NO and a molecular weight of 283.66 g/mol. IUPAC name: 3-amino-2-(4,4-difluorocyclohexyl)-1,1,1-trifluoropropan-2-ol;hydrochloride. InChIKey: JZZVGDBQUUVHCR-UHFFFAOYSA-N.
| Molecular formula | C9H15ClF5NO |
|---|---|
| Molecular weight | 283.66 g/mol |
| IUPAC name | 3-amino-2-(4,4-difluorocyclohexyl)-1,1,1-trifluoropropan-2-ol;hydrochloride |
| InChIKey | JZZVGDBQUUVHCR-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(CN)(C(F)(F)F)O)(F)F.Cl |
Computed by PubChem (NCBI)