Products 2375271-32-0

CAS 2375271-32-0 is the registry number for Ethyl 5-(iodomethyl)-1,3-thiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 5-(iodomethyl)-1,3-thiazole-2-carboxylate (CAS 2375271-32-0) is a chemical compound with the molecular formula C7H8INO2S and a molecular weight of 297.12 g/mol. IUPAC name: ethyl 5-(iodomethyl)-1,3-thiazole-2-carboxylate. InChIKey: KAAWDLUKFZQOBR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8INO2S
Molecular weight297.12 g/mol
IUPAC nameethyl 5-(iodomethyl)-1,3-thiazole-2-carboxylate
InChIKeyKAAWDLUKFZQOBR-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC=C(S1)CI

Computed by PubChem (NCBI)