Products 2375273-11-1

CAS 2375273-11-1 is the registry number for 1-(1-Ethyl-1h-pyrazol-3-yl)-n-methylmethanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-(1-ethylpyrazol-3-yl)-N-methylmethanamine;hydrochloride (CAS 2375273-11-1) is a chemical compound with the molecular formula C7H14ClN3 and a molecular weight of 175.66 g/mol. IUPAC name: 1-(1-ethylpyrazol-3-yl)-N-methylmethanamine;hydrochloride. InChIKey: WNOKRESPDVTMLV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClN3
Molecular weight175.66 g/mol
IUPAC name1-(1-ethylpyrazol-3-yl)-N-methylmethanamine;hydrochloride
InChIKeyWNOKRESPDVTMLV-UHFFFAOYSA-N
SMILESCCN1C=CC(=N1)CNC.Cl

Computed by PubChem (NCBI)