Products 2375273-27-9

CAS 2375273-27-9 is the registry number for 5-((2-Aminopropyl)amino)-2-chlorobenzoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-(2-aminopropylamino)-2-chlorobenzoic acid;dihydrochloride (CAS 2375273-27-9) is a chemical compound with the molecular formula C10H15Cl3N2O2 and a molecular weight of 301.6 g/mol. IUPAC name: 5-(2-aminopropylamino)-2-chlorobenzoic acid;dihydrochloride. InChIKey: DYTSXXQFIYBIFT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15Cl3N2O2
Molecular weight301.6 g/mol
IUPAC name5-(2-aminopropylamino)-2-chlorobenzoic acid;dihydrochloride
InChIKeyDYTSXXQFIYBIFT-UHFFFAOYSA-N
SMILESCC(CNC1=CC(=C(C=C1)Cl)C(=O)O)N.Cl.Cl

Computed by PubChem (NCBI)