CAS 2375273-85-9 is the registry number for 7-(Aminomethyl)-(1,2,4)triazolo(1,5-a)pyridin-2-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine;dihydrochloride (CAS 2375273-85-9) is a chemical compound with the molecular formula C7H11Cl2N5 and a molecular weight of 236.10 g/mol. IUPAC name: 7-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine;dihydrochloride. InChIKey: KLANTHYHWHXBMK-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2N5 |
|---|---|
| Molecular weight | 236.10 g/mol |
| IUPAC name | 7-(aminomethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine;dihydrochloride |
| InChIKey | KLANTHYHWHXBMK-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)N)C=C1CN.Cl.Cl |
Computed by PubChem (NCBI)