CAS 2375274-21-6 is the registry number for Methyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate;hydrobromide (CAS 2375274-21-6) is a chemical compound with the molecular formula C6H9BrN2O2S and a molecular weight of 253.12 g/mol. IUPAC name: methyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate;hydrobromide. InChIKey: SYYQMOYHTUQLLS-UHFFFAOYSA-N.
| Molecular formula | C6H9BrN2O2S |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | methyl 2-amino-5-methyl-1,3-thiazole-4-carboxylate;hydrobromide |
| InChIKey | SYYQMOYHTUQLLS-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)N)C(=O)OC.Br |
Computed by PubChem (NCBI)