Products 2375274-46-5

CAS 2375274-46-5 is the registry number for 1-Hydroxy-4-methyl-1H-imidazole-5-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-hydroxy-5-methylimidazole-4-carboxylic acid;hydrochloride (CAS 2375274-46-5) is a chemical compound with the molecular formula C5H7ClN2O3 and a molecular weight of 178.57 g/mol. IUPAC name: 3-hydroxy-5-methylimidazole-4-carboxylic acid;hydrochloride. InChIKey: WKYUNFRYOLRHIL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7ClN2O3
Molecular weight178.57 g/mol
IUPAC name3-hydroxy-5-methylimidazole-4-carboxylic acid;hydrochloride
InChIKeyWKYUNFRYOLRHIL-UHFFFAOYSA-N
SMILESCC1=C(N(C=N1)O)C(=O)O.Cl

Computed by PubChem (NCBI)