CAS 2375283-62-6 appears in our catalog under these names: Thalidomide–NH–PEG3–COOH, Thalidomide-NH-PEG3-COOH 97%, PROPANOIC ACID, 3-[2-[2-[2-[[2-(2,6-DIO&, Thalidomide-NH-PEG3-COOH, 97%, 97%, Thalidomide-NH-PEG3-COOH, 98.90%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 50mg, 100mg, 250mg, 1g, 10 mg, 50 mg, 5 mg, 100 mg.
3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2375283-62-6) is a chemical compound with the molecular formula C22H27N3O9 and a molecular weight of 477.5 g/mol. IUPAC name: 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: SYFPHSMLSPHFLO-UHFFFAOYSA-N.
| Molecular formula | C22H27N3O9 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | SYFPHSMLSPHFLO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)NCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)