CAS 2375357-96-1 appears in our catalog under these names: Ferroptosis inducer–1, Ferroptosis inducer-1, 98.80%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 100 mg, 10mM/1mL, 5 mg, 50 mg.
Methyl (1S,3R)-2-(2-chloroacetyl)-1-(4-prop-2-ynoxycarbonylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (CAS 2375357-96-1) is a chemical compound with the molecular formula C25H21ClN2O5 and a molecular weight of 464.9 g/mol. IUPAC name: methyl (1S,3R)-2-(2-chloroacetyl)-1-(4-prop-2-ynoxycarbonylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate. InChIKey: AEFRDVDAQLIGSO-OFNKIYASSA-N.
| Molecular formula | C25H21ClN2O5 |
|---|---|
| Molecular weight | 464.9 g/mol |
| IUPAC name | methyl (1S,3R)-2-(2-chloroacetyl)-1-(4-prop-2-ynoxycarbonylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| InChIKey | AEFRDVDAQLIGSO-OFNKIYASSA-N |
| SMILES | COC(=O)[C@H]1CC2=C([C@@H](N1C(=O)CCl)C3=CC=C(C=C3)C(=O)OCC#C)NC4=CC=CC=C24 |
Computed by PubChem (NCBI)