CAS 2375659-15-5 is the registry number for NRMA-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-N-[2-[4-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]oxyphenyl]ethyl]benzamide (CAS 2375659-15-5) is a chemical compound with the molecular formula C20H23ClN2O3 and a molecular weight of 374.9 g/mol. IUPAC name: 4-chloro-N-[2-[4-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]oxyphenyl]ethyl]benzamide. InChIKey: XUFQGSCSSYRXLU-UHFFFAOYSA-N.
| Molecular formula | C20H23ClN2O3 |
|---|---|
| Molecular weight | 374.9 g/mol |
| IUPAC name | 4-chloro-N-[2-[4-[2-methyl-1-(methylamino)-1-oxopropan-2-yl]oxyphenyl]ethyl]benzamide |
| InChIKey | XUFQGSCSSYRXLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NC)OC1=CC=C(C=C1)CCNC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)