Products 2375720-19-5
CAS 2375720-19-5 is the registry number for 2',5'-Bis((1H-imidazol-1-yl)methyl)-[1,1':4',1''-terphenyl]-4,4''-dicarbaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[4-(4-formylphenyl)-2,5-bis(imidazol-1-ylmethyl)phenyl]benzaldehyde (CAS 2375720-19-5) is a chemical compound with the molecular formula C28H22N4O2 and a molecular weight of 446.5 g/mol. IUPAC name: 4-[4-(4-formylphenyl)-2,5-bis(imidazol-1-ylmethyl)phenyl]benzaldehyde. InChIKey: NOEONHUBQBAFJL-UHFFFAOYSA-N.
| Molecular formula | C28H22N4O2 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 4-[4-(4-formylphenyl)-2,5-bis(imidazol-1-ylmethyl)phenyl]benzaldehyde |
| InChIKey | NOEONHUBQBAFJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=C(C=C2CN3C=CN=C3)C4=CC=C(C=C4)C=O)CN5C=CN=C5 |
Computed by PubChem (NCBI)