Products 2382010-56-0
CAS 2382010-56-0 is the registry number for 4,4'-(Anthracene-9,10-diyl)di(benzohydrazide), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[10-[4-(hydrazinecarbonyl)phenyl]anthracen-9-yl]benzohydrazide (CAS 2382010-56-0) is a chemical compound with the molecular formula C28H22N4O2 and a molecular weight of 446.5 g/mol. IUPAC name: 4-[10-[4-(hydrazinecarbonyl)phenyl]anthracen-9-yl]benzohydrazide. InChIKey: HLCGZRREPAJEOJ-UHFFFAOYSA-N.
| Molecular formula | C28H22N4O2 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 4-[10-[4-(hydrazinecarbonyl)phenyl]anthracen-9-yl]benzohydrazide |
| InChIKey | HLCGZRREPAJEOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2C4=CC=C(C=C4)C(=O)NN)C5=CC=C(C=C5)C(=O)NN |
Computed by PubChem (NCBI)