CAS 2375814-28-9 appears in our catalog under these names: 2,4-Dimethyl-1-(4-(Trifluoromethyl)Benzyl)-1H-Pyrrole-3-Carboxylic Acid, 95%, 95%, 2,4-Dimethyl-1-(4-(trifluoromethyl)benzyl)-1H-pyrrole-3-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,4-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-3-carboxylic acid (CAS 2375814-28-9) is a chemical compound with the molecular formula C15H14F3NO2 and a molecular weight of 297.27 g/mol. IUPAC name: 2,4-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-3-carboxylic acid. InChIKey: RZBFQNSNLORSFU-UHFFFAOYSA-N.
| Molecular formula | C15H14F3NO2 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | 2,4-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-3-carboxylic acid |
| InChIKey | RZBFQNSNLORSFU-UHFFFAOYSA-N |
| SMILES | CC1=CN(C(=C1C(=O)O)C)CC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)