CAS 2375917-12-5 is the registry number for Rel-benzyl ((1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]carbamate (CAS 2375917-12-5) is a chemical compound with the molecular formula C15H19FN2O2 and a molecular weight of 278.32 g/mol. IUPAC name: benzyl N-[(1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]carbamate. InChIKey: AAAWMTCNKOADEP-RFQIPJPRSA-N.
| Molecular formula | C15H19FN2O2 |
|---|---|
| Molecular weight | 278.32 g/mol |
| IUPAC name | benzyl N-[(1R,2R,3S,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]carbamate |
| InChIKey | AAAWMTCNKOADEP-RFQIPJPRSA-N |
| SMILES | C1C[C@@H]2[C@H]([C@H](C[C@H]1N2)NC(=O)OCC3=CC=CC=C3)F |
Computed by PubChem (NCBI)