CAS 2375917-51-2 is the registry number for 5-Bromo-3,4-dichloro-2-methyl-2H-indazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3,4-dichloro-2-methylindazole (CAS 2375917-51-2) is a chemical compound with the molecular formula C8H5BrCl2N2 and a molecular weight of 279.95 g/mol. IUPAC name: 5-bromo-3,4-dichloro-2-methylindazole. InChIKey: LEEVBSOXWBIJIN-UHFFFAOYSA-N.
| Molecular formula | C8H5BrCl2N2 |
|---|---|
| Molecular weight | 279.95 g/mol |
| IUPAC name | 5-bromo-3,4-dichloro-2-methylindazole |
| InChIKey | LEEVBSOXWBIJIN-UHFFFAOYSA-N |
| SMILES | CN1C(=C2C(=N1)C=CC(=C2Cl)Br)Cl |
Computed by PubChem (NCBI)