CAS 2375918-49-1 is the registry number for Rel-tert-butyl (1R,2S,3R,5S)-3-amino-2-fluoro-8-azabicyclo(3.2.1)octane-8-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (1S,2R,3S,5R)-3-amino-2-fluoro-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 2375918-49-1) is a chemical compound with the molecular formula C12H21FN2O2 and a molecular weight of 244.31 g/mol. IUPAC name: tert-butyl (1S,2R,3S,5R)-3-amino-2-fluoro-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: WAGXKXDDIIXGOM-XFWSIPNHSA-N.
| Molecular formula | C12H21FN2O2 |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | tert-butyl (1S,2R,3S,5R)-3-amino-2-fluoro-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | WAGXKXDDIIXGOM-XFWSIPNHSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1[C@@H]([C@H](C2)N)F |
Computed by PubChem (NCBI)