CAS 2375919-37-0 is the registry number for tert-Butyl ((1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]carbamate (CAS 2375919-37-0) is a chemical compound with the molecular formula C12H21FN2O2 and a molecular weight of 244.31 g/mol. IUPAC name: tert-butyl N-[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]carbamate. InChIKey: NBYONZZBTJZHTF-XFWSIPNHSA-N.
| Molecular formula | C12H21FN2O2 |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]carbamate |
| InChIKey | NBYONZZBTJZHTF-XFWSIPNHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H]2CC[C@@H]([C@H]1F)N2 |
Computed by PubChem (NCBI)