CAS 2375923-72-9 is the registry number for rel-1-Bromo-3-(((1R,2S)-2-fluorocyclopropyl)sulfonyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3-[(1R,2S)-2-fluorocyclopropyl]sulfonylbenzene (CAS 2375923-72-9) is a chemical compound with the molecular formula C9H8BrFO2S and a molecular weight of 279.13 g/mol. IUPAC name: 1-bromo-3-[(1R,2S)-2-fluorocyclopropyl]sulfonylbenzene. InChIKey: USHLVYGINIDPIS-DTWKUNHWSA-N.
| Molecular formula | C9H8BrFO2S |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 1-bromo-3-[(1R,2S)-2-fluorocyclopropyl]sulfonylbenzene |
| InChIKey | USHLVYGINIDPIS-DTWKUNHWSA-N |
| SMILES | C1[C@@H]([C@@H]1S(=O)(=O)C2=CC(=CC=C2)Br)F |
Computed by PubChem (NCBI)