CAS 2376111-92-9 appears in our catalog under these names: Amino-PEG7-acid, 98%, Amino-PEG7-acid/ 98.28% (existing batch purity), Amino–PEG7–acid, 1-Amino-3,6,9,12,15,18,21-heptaoxatetracosan-24-oic acid, 98%, 98%, Amino-PEG7-acid, 98.0%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
3-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2376111-92-9) is a chemical compound with the molecular formula C17H35NO9 and a molecular weight of 397.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: IQXCHVHWNHSNMT-UHFFFAOYSA-N.
| Molecular formula | C17H35NO9 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | IQXCHVHWNHSNMT-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCN)C(=O)O |
Computed by PubChem (NCBI)