CAS 2376300-37-5 is the registry number for Cyclohexyl 3-(naphthalen-1-yl)-3-(phenylsulfonyl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclohexyl 3-(benzenesulfonyl)-3-naphthalen-1-ylpropanoate (CAS 2376300-37-5) is a chemical compound with the molecular formula C25H26O4S and a molecular weight of 422.5 g/mol. IUPAC name: cyclohexyl 3-(benzenesulfonyl)-3-naphthalen-1-ylpropanoate. InChIKey: AUFXQZHQBGKVOP-UHFFFAOYSA-N.
| Molecular formula | C25H26O4S |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | cyclohexyl 3-(benzenesulfonyl)-3-naphthalen-1-ylpropanoate |
| InChIKey | AUFXQZHQBGKVOP-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)OC(=O)CC(C2=CC=CC3=CC=CC=C32)S(=O)(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)